C23H38O5 — CID 70251780
(Z)-7-[(1R,2R,3R)-3-ethoxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2-methoxyhept-5-enoic acid (PubChem CID 70251780) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-3-ethoxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2-methoxyhept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-3-ethoxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2-methoxyhept-5-enoic acid |
|---|---|
| PubChem CID | 70251780 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-3-ethoxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]-2-methoxyhept-5-enoic acid |
| SMILES | CCCCCC/C=C/[C@H]1[C@H](OCC)CC(=O)[C@@H]1C/C=C\CCC(OC)C(=O)O |
| InChI | InChI=1S/C23H38O5/c1-4-6-7-8-9-11-15-19-18(20(24)17-22(19)28-5-2)14-12-10-13-16-21(27-3)23(25)26/h10-12,15,18-19,21-22H,4-9,13-14,16-17H2,1-3H3,(H,25,26)/b12-10-,15-11+/t18-,19-,21?,22-/m1/s1 |
| InChIKey | XNLFDIYWNYSJDA-SRJROOJXSA-N |
| XLogP | 4.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|