C26H40N3O5+ — CID 59881730
(Z)-7-[(2R)-3-[4-(2-amino-2-carboxyethyl)-2H-imidazol-1-ium-1-yl]-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 59881730) has the molecular formula C26H40N3O5+ and a molecular weight of 474.62 g/mol. Its IUPAC name is (Z)-7-[(2R)-3-[4-(2-amino-2-carboxyethyl)-2H-imidazol-1-ium-1-yl]-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-3-[4-(2-amino-2-carboxyethyl)-2H-imidazol-1-ium-1-yl]-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59881730 |
| Molecular Formula | C26H40N3O5+ |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (Z)-7-[(2R)-3-[4-(2-amino-2-carboxyethyl)-2H-imidazol-1-ium-1-yl]-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC/C=C/[C@@H]1C(C/C=C\CCCC(=O)O)C(=O)CC1[N+]1=CC(CC(N)C(=O)O)=NC1 |
| InChI | InChI=1S/C26H39N3O5/c1-2-3-4-5-6-9-12-20-21(13-10-7-8-11-14-25(31)32)24(30)16-23(20)29-17-19(28-18-29)15-22(27)26(33)34/h7,9-10,12,17,20-23H,2-6,8,11,13-16,18,27H2,1H3,(H-,31,32,33,34)/p+1/b10-7-,12-9+/t20-,21?,22?,23?/m1/s1 |
| InChIKey | DNOXXQLHBBKMFR-BCLWHVAISA-O |
| XLogP | 3.59 |
| TPSA | 133.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|