C26H39N3O6 — CID 163735411
(Z)-7-[(1R,2R)-3-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 163735411) has the molecular formula C26H39N3O6 and a molecular weight of 489.61 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-3-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-3-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 163735411 |
| Molecular Formula | C26H39N3O6 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (Z)-7-[(1R,2R)-3-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(n2cnc(C[C@H](N)C(=O)O)c2)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C26H39N3O6/c1-2-3-6-9-19(30)12-13-20-21(10-7-4-5-8-11-25(32)33)24(31)15-23(20)29-16-18(28-17-29)14-22(27)26(34)35/h4,7,12-13,16-17,19-23,30H,2-3,5-6,8-11,14-15,27H2,1H3,(H,32,33)(H,34,35)/b7-4-,13-12+/t19-,20+,21+,22-,23?/m0/s1 |
| InChIKey | LDDRHIRDIMOTGU-KFHGLXNGSA-N |
| XLogP | 3.28 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|