C23H34N2O4 — CID 44578304
(Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-imidazol-1-yl-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 44578304) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-imidazol-1-yl-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-imidazol-1-yl-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 44578304 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-imidazol-1-yl-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](n2ccnc2)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C23H34N2O4/c1-2-3-6-9-18(26)12-13-19-20(10-7-4-5-8-11-23(28)29)22(27)16-21(19)25-15-14-24-17-25/h4,7,12-15,17-21,26H,2-3,5-6,8-11,16H2,1H3,(H,28,29)/b7-4-,13-12+/t18-,19+,20+,21+/m0/s1 |
| InChIKey | BSCLOEYKOFPVRZ-VLTJKTHFSA-N |
| XLogP | 4.33 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|