C38H54O5 — CID 10930011
(2R,3R,4R)-2-[(Z)-7-(1-ethoxyethoxy)hept-2-enyl]-4-phenylmethoxy-3-[(E,3S)-3-phenylmethoxyoct-1-enyl]cyclopentan-1-one (PubChem CID 10930011) has the molecular formula C38H54O5 and a molecular weight of 590.85 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(Z)-7-(1-ethoxyethoxy)hept-2-enyl]-4-phenylmethoxy-3-[(E,3S)-3-phenylmethoxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-2-[(Z)-7-(1-ethoxyethoxy)hept-2-enyl]-4-phenylmethoxy-3-[(E,3S)-3-phenylmethoxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 10930011 |
| Molecular Formula | C38H54O5 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | (2R,3R,4R)-2-[(Z)-7-(1-ethoxyethoxy)hept-2-enyl]-4-phenylmethoxy-3-[(E,3S)-3-phenylmethoxyoct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](OCc2ccccc2)CC(=O)[C@@H]1C/C=C\CCCCOC(C)OCC)OCc1ccccc1 |
| InChI | InChI=1S/C38H54O5/c1-4-6-12-23-34(42-29-32-19-13-10-14-20-32)25-26-36-35(24-17-8-7-9-18-27-41-31(3)40-5-2)37(39)28-38(36)43-30-33-21-15-11-16-22-33/h8,10-11,13-17,19-22,25-26,31,34-36,38H,4-7,9,12,18,23-24,27-30H2,1-3H3/b17-8-,26-25+/t31?,34-,35+,36+,38+/m0/s1 |
| InChIKey | RYMRXVKYDKRZIH-TVTJFYFDSA-N |
| XLogP | 9.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|