C28H36O4 — CID 10884627
(1S,2S,3R,5R)-3-phenylmethoxy-2-[(E,3S)-3-phenylmethoxyoct-1-enyl]-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 10884627) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is (1S,2S,3R,5R)-3-phenylmethoxy-2-[(E,3S)-3-phenylmethoxyoct-1-enyl]-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1S,2S,3R,5R)-3-phenylmethoxy-2-[(E,3S)-3-phenylmethoxyoct-1-enyl]-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10884627 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (1S,2S,3R,5R)-3-phenylmethoxy-2-[(E,3S)-3-phenylmethoxyoct-1-enyl]-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](OCc2ccccc2)C[C@@H]2OC[C@H]1O2)OCc1ccccc1 |
| InChI | InChI=1S/C28H36O4/c1-2-3-6-15-24(29-19-22-11-7-4-8-12-22)16-17-25-26(18-28-31-21-27(25)32-28)30-20-23-13-9-5-10-14-23/h4-5,7-14,16-17,24-28H,2-3,6,15,18-21H2,1H3/b17-16+/t24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | MQKBTZYRGACMRM-RTYNNDQNSA-N |
| XLogP | 6.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|