C20H30O2 — CID 66559963
(2R)-2-[(E,1S)-1-phenylmethoxyundec-2-enyl]oxirane (PubChem CID 66559963) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (2R)-2-[(E,1S)-1-phenylmethoxyundec-2-enyl]oxirane.
| Compound Name | (2R)-2-[(E,1S)-1-phenylmethoxyundec-2-enyl]oxirane |
|---|---|
| PubChem CID | 66559963 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (2R)-2-[(E,1S)-1-phenylmethoxyundec-2-enyl]oxirane |
| SMILES | CCCCCCCC/C=C/[C@H](OCc1ccccc1)[C@H]1CO1 |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-12-15-19(20-17-22-20)21-16-18-13-10-9-11-14-18/h9-15,19-20H,2-8,16-17H2,1H3/b15-12+/t19-,20+/m0/s1 |
| InChIKey | PMZOZZYUDQBVFX-DQEWXYAXSA-N |
| XLogP | 5.28 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|