C38H48O4 — CID 11180597
benzyl (2E,4R,5R,6E)-4,5-bis(phenylmethoxy)heptadeca-2,6-dienoate (PubChem CID 11180597) has the molecular formula C38H48O4 and a molecular weight of 568.80 g/mol. Its IUPAC name is benzyl (2E,4R,5R,6E)-4,5-bis(phenylmethoxy)heptadeca-2,6-dienoate.
| Compound Name | benzyl (2E,4R,5R,6E)-4,5-bis(phenylmethoxy)heptadeca-2,6-dienoate |
|---|---|
| PubChem CID | 11180597 |
| Molecular Formula | C38H48O4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | benzyl (2E,4R,5R,6E)-4,5-bis(phenylmethoxy)heptadeca-2,6-dienoate |
| SMILES | CCCCCCCCCC/C=C/[C@@H](OCc1ccccc1)[C@@H](/C=C/C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H48O4/c1-2-3-4-5-6-7-8-9-10-20-27-36(40-30-33-21-14-11-15-22-33)37(41-31-34-23-16-12-17-24-34)28-29-38(39)42-32-35-25-18-13-19-26-35/h11-29,36-37H,2-10,30-32H2,1H3/b27-20+,29-28+/t36-,37-/m1/s1 |
| InChIKey | PBKMBDGHYOTRGN-AFTNGNBXSA-N |
| XLogP | 9.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|