C28H41NO5 — CID 70566671
[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-phenylcarbamate (PubChem CID 70566671) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-phenylcarbamate.
| Compound Name | [(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 70566671 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-phenylcarbamate |
| SMILES | CCCCC(C)[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H41NO5/c1-3-4-13-21(2)25(30)18-17-24-23(26(31)20-27(24)32)16-11-6-5-7-12-19-34-28(33)29-22-14-9-8-10-15-22/h6,8-11,14-15,17-18,21,23-25,27,30,32H,3-5,7,12-13,16,19-20H2,1-2H3,(H,29,33)/b11-6-,18-17+/t21?,23-,24-,25-,27-/m1/s1 |
| InChIKey | ICQIJZSHURBWIQ-APQWXYSESA-N |
| XLogP | 5.66 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|