C23H37NO3S — CID 88765024
O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate (PubChem CID 88765024) has the molecular formula C23H37NO3S and a molecular weight of 407.62 g/mol. Its IUPAC name is O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate.
| Compound Name | O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 88765024 |
| Molecular Formula | C23H37NO3S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate |
| SMILES | CCCCC(C)[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCCOC(=S)NC |
| InChI | InChI=1S/C23H37NO3S/c1-4-5-11-18(2)21(25)15-13-19-14-16-22(26)20(19)12-9-7-6-8-10-17-27-23(28)24-3/h7,9,13-16,18-21,25H,4-6,8,10-12,17H2,1-3H3,(H,24,28)/b9-7-,15-13+/t18?,19-,20+,21+/m0/s1 |
| InChIKey | PPEMBDBYWZLSCA-RZDOOQQSSA-N |
| XLogP | 4.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|