C22H35NO3S — CID 88766525
O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate (PubChem CID 88766525) has the molecular formula C22H35NO3S and a molecular weight of 393.59 g/mol. Its IUPAC name is O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate.
| Compound Name | O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 88766525 |
| Molecular Formula | C22H35NO3S |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | O-[(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enyl] N-methylcarbamothioate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCCOC(=S)NC |
| InChI | InChI=1S/C22H35NO3S/c1-3-4-8-11-19(24)15-13-18-14-16-21(25)20(18)12-9-6-5-7-10-17-26-22(27)23-2/h6,9,13-16,18-20,24H,3-5,7-8,10-12,17H2,1-2H3,(H,23,27)/b9-6-,15-13+/t18-,19-,20+/m0/s1 |
| InChIKey | SCPPSMCKDXFJAD-SJYHUYHPSA-N |
| XLogP | 4.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|