C21H28O4 — CID 70588199
(Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 70588199) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70588199 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CC#CCC(C)[C@H](O)/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C21H28O4/c1-3-4-9-16(2)19(22)14-12-17-13-15-20(23)18(17)10-7-5-6-8-11-21(24)25/h5,7,12-19,22H,6,8-11H2,1-2H3,(H,24,25)/b7-5-,14-12+/t16?,17-,18+,19+/m0/s1 |
| InChIKey | DFTQFKMFLHMRDL-OYJNQCQKSA-N |
| XLogP | 3.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|