C21H28O4 — CID 57203575
2-(hydroxymethyl)-7-[(1R,2S)-2-oct-1-en-6-ynyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 57203575) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-(hydroxymethyl)-7-[(1R,2S)-2-oct-1-en-6-ynyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | 2-(hydroxymethyl)-7-[(1R,2S)-2-oct-1-en-6-ynyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57203575 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-(hydroxymethyl)-7-[(1R,2S)-2-oct-1-en-6-ynyl-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CC#CCCCC=C[C@H]1C=CC(=O)[C@@H]1CC=CCCC(CO)C(=O)O |
| InChI | InChI=1S/C21H28O4/c1-2-3-4-5-6-8-11-17-14-15-20(23)19(17)13-10-7-9-12-18(16-22)21(24)25/h7-8,10-11,14-15,17-19,22H,4-6,9,12-13,16H2,1H3,(H,24,25)/t17-,18?,19+/m0/s1 |
| InChIKey | YVVBDXGSPGBPEW-LJJQOFDWSA-N |
| XLogP | 3.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|