C21H31FO4 — CID 88769777
(E)-7-[(1R,2R,3R)-2-[(4R)-4-fluoro-3-oxooct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 88769777) has the molecular formula C21H31FO4 and a molecular weight of 366.47 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R)-2-[(4R)-4-fluoro-3-oxooct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R)-2-[(4R)-4-fluoro-3-oxooct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88769777 |
| Molecular Formula | C21H31FO4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (E)-7-[(1R,2R,3R)-2-[(4R)-4-fluoro-3-oxooct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCC[C@@H](F)C(=O)C=C[C@H]1[C@H](C)CC(=O)[C@@H]1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C21H31FO4/c1-3-4-10-18(22)19(23)13-12-16-15(2)14-20(24)17(16)9-7-5-6-8-11-21(25)26/h5,7,12-13,15-18H,3-4,6,8-11,14H2,1-2H3,(H,25,26)/b7-5+,13-12?/t15-,16+,17-,18-/m1/s1 |
| InChIKey | LZUOXOQWUPLTDF-GOZRSFFBSA-N |
| XLogP | 4.68 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|