C24H41NO4 — CID 57321368
[1-hydroxy-7-[(1R,2R,3R)-3-methyl-2-[(3S)-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-methylcarbamate (PubChem CID 57321368) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is [1-hydroxy-7-[(1R,2R,3R)-3-methyl-2-[(3S)-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-methylcarbamate.
| Compound Name | [1-hydroxy-7-[(1R,2R,3R)-3-methyl-2-[(3S)-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-methylcarbamate |
|---|---|
| PubChem CID | 57321368 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | [1-hydroxy-7-[(1R,2R,3R)-3-methyl-2-[(3S)-3-methyloct-1-enyl]-5-oxocyclopentyl]hept-5-enyl] N-methylcarbamate |
| SMILES | CCCCC[C@H](C)C=C[C@H]1[C@H](C)CC(=O)[C@@H]1CC=CCCCC(O)OC(=O)NC |
| InChI | InChI=1S/C24H41NO4/c1-5-6-9-12-18(2)15-16-20-19(3)17-22(26)21(20)13-10-7-8-11-14-23(27)29-24(28)25-4/h7,10,15-16,18-21,23,27H,5-6,8-9,11-14,17H2,1-4H3,(H,25,28)/t18-,19+,20-,21+,23?/m0/s1 |
| InChIKey | ZLJDEBGMWCPXBZ-FTVKEDAGSA-N |
| XLogP | 5.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|