C30H54O4Si — CID 159889572
propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 159889572) has the molecular formula C30H54O4Si and a molecular weight of 506.84 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 159889572 |
| Molecular Formula | C30H54O4Si |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@H](C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O4Si/c1-10-11-14-17-25(34-35(8,9)30(5,6)7)20-21-26-24(4)22-28(31)27(26)18-15-12-13-16-19-29(32)33-23(2)3/h12,15,20-21,23-27H,10-11,13-14,16-19,22H2,1-9H3/b15-12-,21-20+/t24-,25+,26+,27-/m1/s1 |
| InChIKey | NQJDKMIMTHFPLS-BHWMRNHLSA-N |
| XLogP | 8.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|