C31H42F2O4 — CID 118654923
propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(1E,5E)-4,4-difluoro-3-phenylmethoxyocta-1,5-dienyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 118654923) has the molecular formula C31H42F2O4 and a molecular weight of 516.67 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(1E,5E)-4,4-difluoro-3-phenylmethoxyocta-1,5-dienyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(1E,5E)-4,4-difluoro-3-phenylmethoxyocta-1,5-dienyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 118654923 |
| Molecular Formula | C31H42F2O4 |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R)-2-[(1E,5E)-4,4-difluoro-3-phenylmethoxyocta-1,5-dienyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC/C=C/C(F)(F)C(/C=C/[C@H]1[C@H](C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C31H42F2O4/c1-5-6-20-31(32,33)29(36-22-25-14-10-9-11-15-25)19-18-26-24(4)21-28(34)27(26)16-12-7-8-13-17-30(35)37-23(2)3/h6-7,9-12,14-15,18-20,23-24,26-27,29H,5,8,13,16-17,21-22H2,1-4H3/b12-7-,19-18+,20-6+/t24-,26+,27-,29?/m1/s1 |
| InChIKey | NQKYVLRLRURBPA-HYGKHSBLSA-N |
| XLogP | 7.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|