C27H34F2O5 — CID 67578195
benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-6-methyl-3-oxohept-1-enyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 67578195) has the molecular formula C27H34F2O5 and a molecular weight of 476.56 g/mol. Its IUPAC name is benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-6-methyl-3-oxohept-1-enyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-6-methyl-3-oxohept-1-enyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67578195 |
| Molecular Formula | C27H34F2O5 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | benzyl 7-[(1R,2R,3R)-2-(4,4-difluoro-6-methyl-3-oxohept-1-enyl)-3-hydroxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(C)CC(F)(F)C(=O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=CCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H34F2O5/c1-19(2)17-27(28,29)25(32)15-14-22-21(23(30)16-24(22)31)12-8-3-4-9-13-26(33)34-18-20-10-6-5-7-11-20/h3,5-8,10-11,14-15,19,21-22,24,31H,4,9,12-13,16-18H2,1-2H3/t21-,22-,24-/m1/s1 |
| InChIKey | CIJRFGGTKPFTMH-CQOQZXRMSA-N |
| XLogP | 5.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|