C23H36O7 — CID 10180713
1,3-dihydroxypropan-2-yl (Z)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 10180713) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (Z)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (Z)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 10180713 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (Z)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(=O)/C=C/C1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C23H36O7/c1-2-3-6-9-17(26)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-18(15-24)16-25/h4,7,12-13,18-20,22,24-25,28H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t19-,20?,22-/m1/s1 |
| InChIKey | JOVJYPXIEZEKMA-QXRFWFAQSA-N |
| XLogP | 2.27 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|