C39H67O11P — CID 156966746
[(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-hexadec-9-enoate (PubChem CID 156966746) has the molecular formula C39H67O11P and a molecular weight of 742.93 g/mol. Its IUPAC name is [(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-hexadec-9-enoate.
| Compound Name | [(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 156966746 |
| Molecular Formula | C39H67O11P |
| Molecular Weight | 742.93 g/mol |
| Exact Mass | 742.44 |
| IUPAC Name | [(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C39H67O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-21-25-38(43)48-30-33(31-49-51(45,46)47)50-39(44)26-22-18-17-20-24-34-35(37(42)29-36(34)41)28-27-32(40)23-19-6-4-2/h10-11,17,20,27-28,32-35,37,40,42H,3-9,12-16,18-19,21-26,29-31H2,1-2H3,(H2,45,46,47)/b11-10-,20-17-,28-27+/t32-,33+,34+,35+,37+/m0/s1 |
| InChIKey | MVCOSPHAUFZBLP-FQTSWVMSSA-N |
| XLogP | 7.99 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.93 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|