C37H63O11P — CID 156966434
[(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate (PubChem CID 156966434) has the molecular formula C37H63O11P and a molecular weight of 714.87 g/mol. Its IUPAC name is [(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate.
| Compound Name | [(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 156966434 |
| Molecular Formula | C37H63O11P |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | [(2R)-2-[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C37H63O11P/c1-3-5-7-8-9-10-11-12-13-14-19-23-36(41)46-28-31(29-47-49(43,44)45)48-37(42)24-20-16-15-18-22-32-33(35(40)27-34(32)39)26-25-30(38)21-17-6-4-2/h8-9,15,18,25-26,30-33,35,38,40H,3-7,10-14,16-17,19-24,27-29H2,1-2H3,(H2,43,44,45)/b9-8-,18-15-,26-25+/t30-,31+,32+,33+,35+/m0/s1 |
| InChIKey | KFKUAUVHPDRPTO-GPVITRKNSA-N |
| XLogP | 7.21 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|