C30H46O9 — CID 10347532
diethyl 2-[(1R,2S,3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate (PubChem CID 10347532) has the molecular formula C30H46O9 and a molecular weight of 550.69 g/mol. Its IUPAC name is diethyl 2-[(1R,2S,3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2S,3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate |
|---|---|
| PubChem CID | 10347532 |
| Molecular Formula | C30H46O9 |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | diethyl 2-[(1R,2S,3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[(Z)-7-methoxy-7-oxohept-2-enyl]-4-oxocyclopentyl]propanedioate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)C(=O)C[C@H]1C(C(=O)OCC)C(=O)OCC)OC(C)=O |
| InChI | InChI=1S/C30H46O9/c1-6-9-12-15-22(39-21(4)31)18-19-23-24(16-13-10-11-14-17-27(33)36-5)26(32)20-25(23)28(29(34)37-7-2)30(35)38-8-3/h10,13,18-19,22-25,28H,6-9,11-12,14-17,20H2,1-5H3/b13-10-,19-18+/t22-,23+,24+,25+/m0/s1 |
| InChIKey | PUKQLZDTEOLJON-HTQUSSSASA-N |
| XLogP | 4.91 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|