C31H49NO9 — CID 10483325
diethyl 2-[(3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[2-[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminoethyl]-4-oxocyclopentyl]propanedioate (PubChem CID 10483325) has the molecular formula C31H49NO9 and a molecular weight of 579.73 g/mol. Its IUPAC name is diethyl 2-[(3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[2-[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminoethyl]-4-oxocyclopentyl]propanedioate.
| Compound Name | diethyl 2-[(3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[2-[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminoethyl]-4-oxocyclopentyl]propanedioate |
|---|---|
| PubChem CID | 10483325 |
| Molecular Formula | C31H49NO9 |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | diethyl 2-[(3R)-2-[(E,3S)-3-acetyloxyoct-1-enyl]-3-[2-[(2S)-1-methoxy-4-methyl-1-oxopentan-2-yl]iminoethyl]-4-oxocyclopentyl]propanedioate |
| SMILES | CCCCC[C@@H](/C=C/C1C(C(C(=O)OCC)C(=O)OCC)CC(=O)[C@@H]1C/C=N/[C@@H](CC(C)C)C(=O)OC)OC(C)=O |
| InChI | InChI=1S/C31H49NO9/c1-8-11-12-13-22(41-21(6)33)14-15-23-24(16-17-32-26(18-20(4)5)29(35)38-7)27(34)19-25(23)28(30(36)39-9-2)31(37)40-10-3/h14-15,17,20,22-26,28H,8-13,16,18-19H2,1-7H3/b15-14+,32-17+/t22-,23?,24+,25?,26-/m0/s1 |
| InChIKey | LFWMIIXCHHHMOX-RYBBVLIESA-N |
| XLogP | 4.67 |
| TPSA | 134.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|