C17H28O5 — CID 24884648
ethyl 2-[(1S,2R,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetate (PubChem CID 24884648) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetate.
| Compound Name | ethyl 2-[(1S,2R,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 24884648 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | ethyl 2-[(1S,2R,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](CC(=O)OCC)C(=O)C[C@@H]1O |
| InChI | InChI=1S/C17H28O5/c1-3-5-6-7-12(18)8-9-13-14(10-17(21)22-4-2)16(20)11-15(13)19/h8-9,12-15,18-19H,3-7,10-11H2,1-2H3/b9-8+/t12-,13+,14-,15-/m0/s1 |
| InChIKey | HPBUBGQTCPAZPE-VOMKZKQKSA-N |
| XLogP | 2.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|