C17H28O4 — CID 71178492
ethyl 2-[(1R,2R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]acetate (PubChem CID 71178492) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,2R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 71178492 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | ethyl 2-[(1R,2R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]-5-oxocyclopentyl]acetate |
| SMILES | CCCCCC/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C17H28O4/c1-3-5-6-7-8-9-10-13-14(11-17(20)21-4-2)16(19)12-15(13)18/h9-10,13-15,18H,3-8,11-12H2,1-2H3/b10-9+/t13-,14-,15-/m1/s1 |
| InChIKey | FTUNRFBPKREVAS-BETSRAJUSA-N |
| XLogP | 3.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|