C25H44O4Si — CID 154404406
propan-2-yl (Z)-7-[(1R,2S,3R)-2-[(E)-but-2-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate (PubChem CID 154404406) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2S,3R)-2-[(E)-but-2-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2S,3R)-2-[(E)-but-2-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 154404406 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2S,3R)-2-[(E)-but-2-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopentyl]hept-5-enoate |
| SMILES | C/C=C(\C)[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC(C)C |
| InChI | InChI=1S/C25H44O4Si/c1-10-19(4)24-20(15-13-11-12-14-16-23(27)28-18(2)3)21(26)17-22(24)29-30(8,9)25(5,6)7/h10-11,13,18,20,22,24H,12,14-17H2,1-9H3/b13-11-,19-10+/t20-,22+,24+/m0/s1 |
| InChIKey | KOFUHEROAGLOPP-DHVJAKMDSA-N |
| XLogP | 6.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|