C35H54O8S — CID 59115983
propan-2-yl (Z)-7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-[(4-methylphenyl)sulfonyloxymethyl]-5-oxocyclopentyl]hept-5-enoate (PubChem CID 59115983) has the molecular formula C35H54O8S and a molecular weight of 634.88 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-[(4-methylphenyl)sulfonyloxymethyl]-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-[(4-methylphenyl)sulfonyloxymethyl]-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59115983 |
| Molecular Formula | C35H54O8S |
| Molecular Weight | 634.88 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-[(4-methylphenyl)sulfonyloxymethyl]-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@H]2[C@H](COS(=O)(=O)c3ccc(C)cc3)CC(=O)[C@@H]2C/C=C\CCCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C35H54O8S/c1-5-6-7-10-13-21-35(40-23-24-41-35)22-20-31-29(26-42-44(38,39)30-18-16-28(4)17-19-30)25-33(36)32(31)14-11-8-9-12-15-34(37)43-27(2)3/h8,11,16-19,27,29,31-32H,5-7,9-10,12-15,20-26H2,1-4H3/b11-8-/t29-,31-,32+/m0/s1 |
| InChIKey | AGRCCXIMXXIDNO-RABIAPHPSA-N |
| XLogP | 7.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.88 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|