C18H34O3Si2 — CID 139655439
4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enyl-3-trimethylsilylcarbonylcyclopentan-1-one (PubChem CID 139655439) has the molecular formula C18H34O3Si2 and a molecular weight of 354.64 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enyl-3-trimethylsilylcarbonylcyclopentan-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enyl-3-trimethylsilylcarbonylcyclopentan-1-one |
|---|---|
| PubChem CID | 139655439 |
| Molecular Formula | C18H34O3Si2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enyl-3-trimethylsilylcarbonylcyclopentan-1-one |
| SMILES | C=CCC1C(=O)CC(O[Si](C)(C)C(C)(C)C)C1C(=O)[Si](C)(C)C |
| InChI | InChI=1S/C18H34O3Si2/c1-10-11-13-14(19)12-15(16(13)17(20)22(5,6)7)21-23(8,9)18(2,3)4/h10,13,15-16H,1,11-12H2,2-9H3 |
| InChIKey | LDTOGZWBMJBOEW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|