C15H29NO3Si — CID 138966247
methyl (2S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 138966247) has the molecular formula C15H29NO3Si and a molecular weight of 299.49 g/mol. Its IUPAC name is methyl (2S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 138966247 |
| Molecular Formula | C15H29NO3Si |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | methyl (2S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CC[C@H]1N[C@H](C(=O)OC)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO3Si/c1-8-9-11-13(10-12(16-11)14(17)18-5)19-20(6,7)15(2,3)4/h8,11-13,16H,1,9-10H2,2-7H3/t11-,12+,13-/m1/s1 |
| InChIKey | UAWSOYMSQZDVJY-FRRDWIJNSA-N |
| XLogP | 2.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|