C18H30O7Si — CID 71545558
prop-2-enyl (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxy-2-oxoethyl)-2-oxooxane-3-carboxylate (PubChem CID 71545558) has the molecular formula C18H30O7Si and a molecular weight of 386.52 g/mol. Its IUPAC name is prop-2-enyl (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxy-2-oxoethyl)-2-oxooxane-3-carboxylate.
| Compound Name | prop-2-enyl (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxy-2-oxoethyl)-2-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 71545558 |
| Molecular Formula | C18H30O7Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | prop-2-enyl (4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxy-2-oxoethyl)-2-oxooxane-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C18H30O7Si/c1-8-9-23-16(20)15-12(10-14(19)22-5)13(11-24-17(15)21)25-26(6,7)18(2,3)4/h8,12-13,15H,1,9-11H2,2-7H3/t12-,13+,15?/m0/s1 |
| InChIKey | OLOFJPQKPWIWRK-IKCIUXDWSA-N |
| XLogP | 2.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|