C22H34O6SSi — CID 89361169
methyl 2-[(1R,2R,4S,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-6-bicyclo[3.1.0]hexanyl]acetate (PubChem CID 89361169) has the molecular formula C22H34O6SSi and a molecular weight of 454.66 g/mol. Its IUPAC name is methyl 2-[(1R,2R,4S,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-6-bicyclo[3.1.0]hexanyl]acetate.
| Compound Name | methyl 2-[(1R,2R,4S,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-6-bicyclo[3.1.0]hexanyl]acetate |
|---|---|
| PubChem CID | 89361169 |
| Molecular Formula | C22H34O6SSi |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | methyl 2-[(1R,2R,4S,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-6-bicyclo[3.1.0]hexanyl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@H]2[C@H]1[C@@H](OS(=O)(=O)c1ccc(C)cc1)C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O6SSi/c1-14-8-10-15(11-9-14)29(24,25)27-17-13-18(28-30(6,7)22(2,3)4)21-16(20(17)21)12-19(23)26-5/h8-11,16-18,20-21H,12-13H2,1-7H3/t16-,17-,18+,20+,21-/m0/s1 |
| InChIKey | PGAVIZYMTOWEOE-NRVIEEGESA-N |
| XLogP | 4.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|