C20H32O6SSi — CID 20640087
(1S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylic acid (PubChem CID 20640087) has the molecular formula C20H32O6SSi and a molecular weight of 428.62 g/mol. Its IUPAC name is (1S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 20640087 |
| Molecular Formula | C20H32O6SSi |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (1S,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C20H32O6SSi/c1-14-7-9-18(10-8-14)27(23,24)25-16-11-15(19(21)22)12-17(13-16)26-28(5,6)20(2,3)4/h7-10,15-17H,11-13H2,1-6H3,(H,21,22)/t15-,16+,17+/m1/s1 |
| InChIKey | GRKXQQXOMYSECP-IKGGRYGDSA-N |
| XLogP | 4.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|