C18H30O4SSi — CID 154451840
[(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl] 4-methylbenzenesulfonate (PubChem CID 154451840) has the molecular formula C18H30O4SSi and a molecular weight of 370.59 g/mol. Its IUPAC name is [(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 154451840 |
| Molecular Formula | C18H30O4SSi |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(1S,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H30O4SSi/c1-14-7-11-17(12-8-14)23(19,20)21-15-9-10-16(13-15)22-24(5,6)18(2,3)4/h7-8,11-12,15-16H,9-10,13H2,1-6H3/t15-,16+/m0/s1 |
| InChIKey | WAXPFMBNMLALIO-JKSUJKDBSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|