C19H32O5SSi — CID 11269588
[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11269588) has the molecular formula C19H32O5SSi and a molecular weight of 400.61 g/mol. Its IUPAC name is [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11269588 |
| Molecular Formula | C19H32O5SSi |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OCCC[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32O5SSi/c1-15-9-11-16(12-10-15)25(20,21)23-14-18-17(8-7-13-22-18)24-26(5,6)19(2,3)4/h9-12,17-18H,7-8,13-14H2,1-6H3/t17-,18+/m0/s1 |
| InChIKey | LVXIGEHOCYRZOO-ZWKOTPCHSA-N |
| XLogP | 4.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|