C20H32O5SSi — CID 102288079
[(2R,3S)-2-[[3-(benzenesulfonyl)oxiran-2-yl]methyl]oxan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102288079) has the molecular formula C20H32O5SSi and a molecular weight of 412.62 g/mol. Its IUPAC name is [(2R,3S)-2-[[3-(benzenesulfonyl)oxiran-2-yl]methyl]oxan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S)-2-[[3-(benzenesulfonyl)oxiran-2-yl]methyl]oxan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102288079 |
| Molecular Formula | C20H32O5SSi |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [(2R,3S)-2-[[3-(benzenesulfonyl)oxiran-2-yl]methyl]oxan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1CC1OC1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H32O5SSi/c1-20(2,3)27(4,5)25-16-12-9-13-23-17(16)14-18-19(24-18)26(21,22)15-10-7-6-8-11-15/h6-8,10-11,16-19H,9,12-14H2,1-5H3/t16-,17+,18?,19?/m0/s1 |
| InChIKey | IPMTVQTZCHAFCC-FKAKGIQBSA-N |
| XLogP | 4.14 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|