C16H21O5SSi — CID 136846141
CID 136846141 (PubChem CID 136846141) has the molecular formula C16H21O5SSi and a molecular weight of 353.49 g/mol.
| Compound Name | CID 136846141 |
|---|---|
| PubChem CID | 136846141 |
| Molecular Formula | C16H21O5SSi |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H](O[Si])C(C[C@@H]2O[C@@H]2S(=O)(=O)c2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C16H21O5SSi/c1-10-8-14(21-23)13(19-11(10)2)9-15-16(20-15)22(17,18)12-6-4-3-5-7-12/h3-7,10-11,13-16H,8-9H2,1-2H3/t10-,11+,13?,14+,15+,16-/m1/s1 |
| InChIKey | XECVKCYFKXRZPC-DCLRAINNSA-N |
| XLogP | 1.86 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|