C19H18O5S2 — CID 14470256
6,7-bis(benzenesulfonyl)-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 14470256) has the molecular formula C19H18O5S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 6,7-bis(benzenesulfonyl)-3-oxatricyclo[3.2.1.02,4]octane.
| Compound Name | 6,7-bis(benzenesulfonyl)-3-oxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 14470256 |
| Molecular Formula | C19H18O5S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 6,7-bis(benzenesulfonyl)-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | O=S(=O)(c1ccccc1)C1C2CC(C3OC23)C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O5S2/c20-25(21,12-7-3-1-4-8-12)18-14-11-15(17-16(14)24-17)19(18)26(22,23)13-9-5-2-6-10-13/h1-10,14-19H,11H2 |
| InChIKey | SAAFSEOBJIWJJX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|