C15H20O3S — CID 102011149
(2S,3R)-2-(benzenesulfonyl)-3-methoxybicyclo[2.2.2]octane (PubChem CID 102011149) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (2S,3R)-2-(benzenesulfonyl)-3-methoxybicyclo[2.2.2]octane.
| Compound Name | (2S,3R)-2-(benzenesulfonyl)-3-methoxybicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 102011149 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S,3R)-2-(benzenesulfonyl)-3-methoxybicyclo[2.2.2]octane |
| SMILES | CO[C@@H]1C2CCC(CC2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O3S/c1-18-14-11-7-9-12(10-8-11)15(14)19(16,17)13-5-3-2-4-6-13/h2-6,11-12,14-15H,7-10H2,1H3/t11?,12?,14-,15+/m1/s1 |
| InChIKey | FDFOCKYCLLHEHD-VHMBPLKRSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |