C13H18O3S — CID 102011153
[(1R,3R)-3-methoxycyclohexyl]sulfonylbenzene (PubChem CID 102011153) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is [(1R,3R)-3-methoxycyclohexyl]sulfonylbenzene.
| Compound Name | [(1R,3R)-3-methoxycyclohexyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102011153 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | [(1R,3R)-3-methoxycyclohexyl]sulfonylbenzene |
| SMILES | CO[C@@H]1CCC[C@@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C13H18O3S/c1-16-11-6-5-9-13(10-11)17(14,15)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | HETGFDRWMWOJJZ-DGCLKSJQSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |