C11H12O4S — CID 10728741
(2R,5R)-2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran (PubChem CID 10728741) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is (2R,5R)-2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran.
| Compound Name | (2R,5R)-2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran |
|---|---|
| PubChem CID | 10728741 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (2R,5R)-2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran |
| SMILES | CO[C@H]1C=C[C@@H](S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C11H12O4S/c1-14-10-7-8-11(15-10)16(12,13)9-5-3-2-4-6-9/h2-8,10-11H,1H3/t10-,11-/m1/s1 |
| InChIKey | OORHUSXECIPXHS-GHMZBOCLSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|