C15H14O3S — CID 135001050
(2R,3R)-2-(benzenesulfonyl)-3-(4-methylphenyl)oxirane (PubChem CID 135001050) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is (2R,3R)-2-(benzenesulfonyl)-3-(4-methylphenyl)oxirane.
| Compound Name | (2R,3R)-2-(benzenesulfonyl)-3-(4-methylphenyl)oxirane |
|---|---|
| PubChem CID | 135001050 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (2R,3R)-2-(benzenesulfonyl)-3-(4-methylphenyl)oxirane |
| SMILES | Cc1ccc([C@H]2O[C@@H]2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14O3S/c1-11-7-9-12(10-8-11)14-15(18-14)19(16,17)13-5-3-2-4-6-13/h2-10,14-15H,1H3/t14-,15-/m1/s1 |
| InChIKey | TWOXYDHXPYTRKM-HUUCEWRRSA-N |
| XLogP | 2.87 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|