C16H14O3 — CID 177461861
(4R,5R)-4-(4-methylphenyl)-5-phenyl-1,3-dioxolan-2-one (PubChem CID 177461861) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is (4R,5R)-4-(4-methylphenyl)-5-phenyl-1,3-dioxolan-2-one.
| Compound Name | (4R,5R)-4-(4-methylphenyl)-5-phenyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 177461861 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (4R,5R)-4-(4-methylphenyl)-5-phenyl-1,3-dioxolan-2-one |
| SMILES | Cc1ccc([C@H]2OC(=O)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O3/c1-11-7-9-13(10-8-11)15-14(18-16(17)19-15)12-5-3-2-4-6-12/h2-10,14-15H,1H3/t14-,15-/m1/s1 |
| InChIKey | WOLJDYMDBHOARO-HUUCEWRRSA-N |
| XLogP | 3.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |