C13H14O2 — CID 45483932
(4R,5S)-5-methyl-3-methylidene-4-(4-methylphenyl)oxolan-2-one (PubChem CID 45483932) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (4R,5S)-5-methyl-3-methylidene-4-(4-methylphenyl)oxolan-2-one.
| Compound Name | (4R,5S)-5-methyl-3-methylidene-4-(4-methylphenyl)oxolan-2-one |
|---|---|
| PubChem CID | 45483932 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (4R,5S)-5-methyl-3-methylidene-4-(4-methylphenyl)oxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](C)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C13H14O2/c1-8-4-6-11(7-5-8)12-9(2)13(14)15-10(12)3/h4-7,10,12H,2H2,1,3H3/t10-,12+/m0/s1 |
| InChIKey | CAIHXFUMFXDTBZ-CMPLNLGQSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|