C18H20O3S — CID 71411447
(2S,3S)-2-(4-methylphenyl)sulfonyl-3-(2,4,6-trimethylphenyl)oxirane (PubChem CID 71411447) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is (2S,3S)-2-(4-methylphenyl)sulfonyl-3-(2,4,6-trimethylphenyl)oxirane.
| Compound Name | (2S,3S)-2-(4-methylphenyl)sulfonyl-3-(2,4,6-trimethylphenyl)oxirane |
|---|---|
| PubChem CID | 71411447 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S,3S)-2-(4-methylphenyl)sulfonyl-3-(2,4,6-trimethylphenyl)oxirane |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2O[C@H]2c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H20O3S/c1-11-5-7-15(8-6-11)22(19,20)18-17(21-18)16-13(3)9-12(2)10-14(16)4/h5-10,17-18H,1-4H3/t17-,18-/m0/s1 |
| InChIKey | ZJNQQDYHIUYFST-ROUUACIJSA-N |
| XLogP | 3.79 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|