C22H23IO3S — CID 172789207
4-methylbenzenesulfonate;phenyl-(2,4,6-trimethylphenyl)iodanium (PubChem CID 172789207) has the molecular formula C22H23IO3S and a molecular weight of 494.39 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethylphenyl)iodanium.
| Compound Name | 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethylphenyl)iodanium |
|---|---|
| PubChem CID | 172789207 |
| Molecular Formula | C22H23IO3S |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethylphenyl)iodanium |
| SMILES | Cc1cc(C)c([I+]c2ccccc2)c(C)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H16I.C7H8O3S/c1-11-9-12(2)15(13(3)10-11)16-14-7-5-4-6-8-14;1-6-2-4-7(5-3-6)11(8,9)10/h4-10H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | PIDJDGTTXOXFPZ-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|