C25H26F3IO3S — CID 139269803
[3-(2-phenylpropan-2-yl)phenyl]-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate (PubChem CID 139269803) has the molecular formula C25H26F3IO3S and a molecular weight of 590.45 g/mol. Its IUPAC name is [3-(2-phenylpropan-2-yl)phenyl]-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate.
| Compound Name | [3-(2-phenylpropan-2-yl)phenyl]-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139269803 |
| Molecular Formula | C25H26F3IO3S |
| Molecular Weight | 590.45 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | [3-(2-phenylpropan-2-yl)phenyl]-(2,4,6-trimethylphenyl)iodanium;trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c([I+]c2cccc(C(C)(C)c3ccccc3)c2)c(C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H26I.CHF3O3S/c1-17-14-18(2)23(19(3)15-17)25-22-13-9-12-21(16-22)24(4,5)20-10-7-6-8-11-20;2-1(3,4)8(5,6)7/h6-16H,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AJRXDBWVHFDMMC-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|