C41H29F18IO6S4 — CID 87706394
diphenyl-[4-[4-(2,4,6-trimethylphenyl)iodoniophenyl]sulfanylphenyl]sulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate) (PubChem CID 87706394) has the molecular formula C41H29F18IO6S4 and a molecular weight of 1214.81 g/mol. Its IUPAC name is diphenyl-[4-[4-(2,4,6-trimethylphenyl)iodoniophenyl]sulfanylphenyl]sulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate).
| Compound Name | diphenyl-[4-[4-(2,4,6-trimethylphenyl)iodoniophenyl]sulfanylphenyl]sulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate) |
|---|---|
| PubChem CID | 87706394 |
| Molecular Formula | C41H29F18IO6S4 |
| Molecular Weight | 1214.81 g/mol |
| Exact Mass | 1213.96 |
| IUPAC Name | diphenyl-[4-[4-(2,4,6-trimethylphenyl)iodoniophenyl]sulfanylphenyl]sulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate) |
| SMILES | Cc1cc(C)c([I+]c2ccc(Sc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2)c(C)c1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H29IS2.2C4HF9O3S/c1-24-22-25(2)33(26(3)23-24)34-27-14-16-28(17-15-27)35-29-18-20-32(21-19-29)36(30-10-6-4-7-11-30)31-12-8-5-9-13-31;2*5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-23H,1-3H3;2*(H,14,15,16)/q+2;;/p-2 |
| InChIKey | HVDMMSFFDHJWBX-UHFFFAOYSA-L |
| XLogP | 9.90 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1214.81 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|