C38H23F18IO6S4 — CID 173141219
[4-[4-(2-iodophenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 173141219) has the molecular formula C38H23F18IO6S4 and a molecular weight of 1172.73 g/mol. Its IUPAC name is [4-[4-(2-iodophenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | [4-[4-(2-iodophenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 173141219 |
| Molecular Formula | C38H23F18IO6S4 |
| Molecular Weight | 1172.73 g/mol |
| Exact Mass | 1171.91 |
| IUPAC Name | [4-[4-(2-iodophenyl)phenyl]sulfanylphenyl]-diphenylsulfanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | Ic1ccccc1-c1ccc(Sc2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H22IS2.2C4HF9O3S/c31-30-14-8-7-13-29(30)23-15-17-24(18-16-23)32-25-19-21-28(22-20-25)33(26-9-3-1-4-10-26)27-11-5-2-6-12-27;2*5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-22H;2*(H,14,15,16)/q+1;;/p-1 |
| InChIKey | QVPAHJATFOWGBZ-UHFFFAOYSA-M |
| XLogP | 13.46 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1172.73 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|