C44H27F17O3S3 — CID 159205923
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;[4-(2-phenylphenyl)phenyl]-[4-(4-phenylphenyl)sulfanylphenyl]sulfanium (PubChem CID 159205923) has the molecular formula C44H27F17O3S3 and a molecular weight of 1022.86 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;[4-(2-phenylphenyl)phenyl]-[4-(4-phenylphenyl)sulfanylphenyl]sulfanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;[4-(2-phenylphenyl)phenyl]-[4-(4-phenylphenyl)sulfanylphenyl]sulfanium |
|---|---|
| PubChem CID | 159205923 |
| Molecular Formula | C44H27F17O3S3 |
| Molecular Weight | 1022.86 g/mol |
| Exact Mass | 1022.09 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;[4-(2-phenylphenyl)phenyl]-[4-(4-phenylphenyl)sulfanylphenyl]sulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc(-c2ccc(Sc3ccc([SH+]c4ccc(-c5ccccc5-c5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H26S2.C8HF17O3S/c1-3-9-27(10-4-1)28-15-19-31(20-16-28)37-33-23-25-34(26-24-33)38-32-21-17-30(18-22-32)36-14-8-7-13-35(36)29-11-5-2-6-12-29;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h1-26H;(H,26,27,28) |
| InChIKey | KPWPKWRCXXWKQH-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.86 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|