C20H10F18O3S2 — CID 174437836
fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;phenylsulfanylbenzene (PubChem CID 174437836) has the molecular formula C20H10F18O3S2 and a molecular weight of 704.39 g/mol. Its IUPAC name is fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;phenylsulfanylbenzene.
| Compound Name | fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;phenylsulfanylbenzene |
|---|---|
| PubChem CID | 174437836 |
| Molecular Formula | C20H10F18O3S2 |
| Molecular Weight | 704.39 g/mol |
| Exact Mass | 703.98 |
| IUPAC Name | fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;phenylsulfanylbenzene |
| SMILES | O=S(=O)(OF)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C8F18O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)30(27,28)29-26/h1-10H; |
| InChIKey | IHJBBFOXWQBOMY-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.39 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|